C15H16N2O — CID 18740850
1,2,5-trimethyl-4H-pyrrolo[1,2-a][1,4]benzodiazepin-6-one (PubChem CID 18740850) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 1,2,5-trimethyl-4H-pyrrolo[1,2-a][1,4]benzodiazepin-6-one.
| Compound Name | 1,2,5-trimethyl-4H-pyrrolo[1,2-a][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 18740850 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1,2,5-trimethyl-4H-pyrrolo[1,2-a][1,4]benzodiazepin-6-one |
| SMILES | Cc1cc2n(c1C)-c1ccccc1C(=O)N(C)C2 |
| InChI | InChI=1S/C15H16N2O/c1-10-8-12-9-16(3)15(18)13-6-4-5-7-14(13)17(12)11(10)2/h4-8H,9H2,1-3H3 |
| InChIKey | JRLSJKBXAOZWGS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|