C17H21N3O4 — CID 18740960
N-[[3-(1-formyl-2-methyl-2,3-dihydroindol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]propanamide (PubChem CID 18740960) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-[[3-(1-formyl-2-methyl-2,3-dihydroindol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]propanamide.
| Compound Name | N-[[3-(1-formyl-2-methyl-2,3-dihydroindol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]propanamide |
|---|---|
| PubChem CID | 18740960 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N-[[3-(1-formyl-2-methyl-2,3-dihydroindol-6-yl)-2-oxo-1,3-oxazolidin-5-yl]methyl]propanamide |
| SMILES | CCC(=O)NCC1CN(c2ccc3c(c2)N(C=O)C(C)C3)C(=O)O1 |
| InChI | InChI=1S/C17H21N3O4/c1-3-16(22)18-8-14-9-19(17(23)24-14)13-5-4-12-6-11(2)20(10-21)15(12)7-13/h4-5,7,10-11,14H,3,6,8-9H2,1-2H3,(H,18,22) |
| InChIKey | VYRKABITYQTKKE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|