C24H30F2N2O — CID 18741324
(1S,9R,13R)-10-[2-[(2,6-difluorophenyl)methoxy]propyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-amine (PubChem CID 18741324) has the molecular formula C24H30F2N2O and a molecular weight of 400.51 g/mol. Its IUPAC name is (1S,9R,13R)-10-[2-[(2,6-difluorophenyl)methoxy]propyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-amine.
| Compound Name | (1S,9R,13R)-10-[2-[(2,6-difluorophenyl)methoxy]propyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-amine |
|---|---|
| PubChem CID | 18741324 |
| Molecular Formula | C24H30F2N2O |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (1S,9R,13R)-10-[2-[(2,6-difluorophenyl)methoxy]propyl]-1,13-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-6-amine |
| SMILES | CC(CN1CC[C@]2(C)c3cccc(N)c3C[C@@H]1[C@@H]2C)OCc1c(F)cccc1F |
| InChI | InChI=1S/C24H30F2N2O/c1-15(29-14-18-20(25)7-5-8-21(18)26)13-28-11-10-24(3)16(2)23(28)12-17-19(24)6-4-9-22(17)27/h4-9,15-16,23H,10-14,27H2,1-3H3/t15?,16-,23+,24-/m0/s1 |
| InChIKey | OFEYREVXBZCAPG-DSHLTTHUSA-N |
| XLogP | 4.68 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|