About methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate
methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate (PubChem CID 18741337) has the molecular formula C5H8N2O3S
and a molecular weight of 176.20 g/mol. Its IUPAC name is methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate.
Molecular Properties
| Compound Name | methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate |
| PubChem CID | 18741337 |
| Molecular Formula | C5H8N2O3S |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate |
| SMILES | COS(=O)c1c(N)noc1C |
| InChI | InChI=1S/C5H8N2O3S/c1-3-4(11(8)9-2)5(6)7-10-3/h1-2H3,(H2,6,7) |
| InChIKey | GJNFWSVTIJOBAH-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate?
The IUPAC name of methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate (CID 18741337) is methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate.
What is the SMILES notation for methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate?
The canonical SMILES for methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate is COS(=O)c1c(N)noc1C.
What is the InChIKey of methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate?
The InChIKey is GJNFWSVTIJOBAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O3S/c1-3-4(11(8)9-2)5(6)7-10-3/h1-2H3,(H2,6,7).
What are the key properties of methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate?
methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate has a molecular weight of 176.20 g/mol, XLogP of 0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-5-methyl-1,2-oxazole-4-sulfinate is sourced from PubChem (CID 18741337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).