C16H15LiN2O2 — CID 18741360
lithium 7-methoxy-1-(phenylmethoxymethyl)-3H-pyrrolo[2,3-c]pyridin-3-ide (PubChem CID 18741360) has the molecular formula C16H15LiN2O2 and a molecular weight of 274.25 g/mol. Its IUPAC name is lithium 7-methoxy-1-(phenylmethoxymethyl)-3H-pyrrolo[2,3-c]pyridin-3-ide.
| Compound Name | lithium 7-methoxy-1-(phenylmethoxymethyl)-3H-pyrrolo[2,3-c]pyridin-3-ide |
|---|---|
| PubChem CID | 18741360 |
| Molecular Formula | C16H15LiN2O2 |
| Molecular Weight | 274.25 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | lithium 7-methoxy-1-(phenylmethoxymethyl)-3H-pyrrolo[2,3-c]pyridin-3-ide |
| SMILES | COc1nccc2[c-]cn(COCc3ccccc3)c12.[Li+] |
| InChI | InChI=1S/C16H15N2O2.Li/c1-19-16-15-14(7-9-17-16)8-10-18(15)12-20-11-13-5-3-2-4-6-13;/h2-7,9-10H,11-12H2,1H3;/q-1;+1 |
| InChIKey | IBLNNQSCIOQHDO-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|