C15H24N6O6 — CID 18745245
2-[[2-[2-[(2-amino-3-hydroxybutanoyl)amino]propanoylamino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18745245) has the molecular formula C15H24N6O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is 2-[[2-[2-[(2-amino-3-hydroxybutanoyl)amino]propanoylamino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[2-[(2-amino-3-hydroxybutanoyl)amino]propanoylamino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18745245 |
| Molecular Formula | C15H24N6O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[[2-[2-[(2-amino-3-hydroxybutanoyl)amino]propanoylamino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CC(NC(=O)C(N)C(C)O)C(=O)NCC(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C15H24N6O6/c1-7(20-14(25)12(16)8(2)22)13(24)18-5-11(23)21-10(15(26)27)3-9-4-17-6-19-9/h4,6-8,10,12,22H,3,5,16H2,1-2H3,(H,17,19)(H,18,24)(H,20,25)(H,21,23)(H,26,27) |
| InChIKey | HPDRNGLGFWFWDH-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 199.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |