C28H33N5O8 — CID 18750630
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid (PubChem CID 18750630) has the molecular formula C28H33N5O8 and a molecular weight of 567.60 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18750630 |
| Molecular Formula | C28H33N5O8 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
| SMILES | CC(O)C(N)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C28H33N5O8/c1-15(34)24(29)27(39)32-20(11-16-7-3-2-4-8-16)25(37)31-21(26(38)33-22(28(40)41)13-23(35)36)12-17-14-30-19-10-6-5-9-18(17)19/h2-10,14-15,20-22,24,30,34H,11-13,29H2,1H3,(H,31,37)(H,32,39)(H,33,38)(H,35,36)(H,40,41) |
| InChIKey | GSNRWDWGUVEJKO-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 223.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |