C19H30N10O4 — CID 18751470
6-[1-[3-[2-(4,6-diamino-1,3,5-triazin-2-yl)propyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]propan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 18751470) has the molecular formula C19H30N10O4 and a molecular weight of 462.52 g/mol. Its IUPAC name is 6-[1-[3-[2-(4,6-diamino-1,3,5-triazin-2-yl)propyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]propan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[1-[3-[2-(4,6-diamino-1,3,5-triazin-2-yl)propyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]propan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 18751470 |
| Molecular Formula | C19H30N10O4 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | 6-[1-[3-[2-(4,6-diamino-1,3,5-triazin-2-yl)propyl]-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]propan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC(CC1OCC2(CO1)COC(CC(C)c1nc(N)nc(N)n1)OC2)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C19H30N10O4/c1-9(13-24-15(20)28-16(21)25-13)3-11-30-5-19(6-31-11)7-32-12(33-8-19)4-10(2)14-26-17(22)29-18(23)27-14/h9-12H,3-8H2,1-2H3,(H4,20,21,24,25,28)(H4,22,23,26,27,29) |
| InChIKey | VBUREMHERYEUBL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 218.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |