C28H25N3O — CID 18751599
1-(1,2-dihydroacenaphthylen-5-yl)-3-(9-hydroxy-9H-fluoren-2-yl)-1,3-dimethylguanidine (PubChem CID 18751599) has the molecular formula C28H25N3O and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-(1,2-dihydroacenaphthylen-5-yl)-3-(9-hydroxy-9H-fluoren-2-yl)-1,3-dimethylguanidine.
| Compound Name | 1-(1,2-dihydroacenaphthylen-5-yl)-3-(9-hydroxy-9H-fluoren-2-yl)-1,3-dimethylguanidine |
|---|---|
| PubChem CID | 18751599 |
| Molecular Formula | C28H25N3O |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-(1,2-dihydroacenaphthylen-5-yl)-3-(9-hydroxy-9H-fluoren-2-yl)-1,3-dimethylguanidine |
| SMILES | [H]/N=C(\N(C)c1ccc2c(c1)C(O)c1ccccc1-2)N(C)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C28H25N3O/c1-30(19-13-14-21-20-7-3-4-8-22(20)27(32)24(21)16-19)28(29)31(2)25-15-12-18-11-10-17-6-5-9-23(25)26(17)18/h3-9,12-16,27,29,32H,10-11H2,1-2H3/b29-28+ |
| InChIKey | MDRYVMBQEZIVGK-ZQHSETAFSA-N |
| XLogP | 5.51 |
| TPSA | 50.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|