C23H25N3 — CID 18751702
1-(1,2-dihydroacenaphthylen-5-yl)-3-(2,3-dimethylphenyl)-1,3-dimethylguanidine (PubChem CID 18751702) has the molecular formula C23H25N3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-(1,2-dihydroacenaphthylen-5-yl)-3-(2,3-dimethylphenyl)-1,3-dimethylguanidine.
| Compound Name | 1-(1,2-dihydroacenaphthylen-5-yl)-3-(2,3-dimethylphenyl)-1,3-dimethylguanidine |
|---|---|
| PubChem CID | 18751702 |
| Molecular Formula | C23H25N3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 1-(1,2-dihydroacenaphthylen-5-yl)-3-(2,3-dimethylphenyl)-1,3-dimethylguanidine |
| SMILES | [H]/N=C(\N(C)c1cccc(C)c1C)N(C)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C23H25N3/c1-15-7-5-10-20(16(15)2)25(3)23(24)26(4)21-14-13-18-12-11-17-8-6-9-19(21)22(17)18/h5-10,13-14,24H,11-12H2,1-4H3/b24-23+ |
| InChIKey | BOQHFKFQFYSIKC-WCWDXBQESA-N |
| XLogP | 5.06 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|