C26H23N3 — CID 18751924
1,2-bis(1,2-dihydroacenaphthylen-5-yl)-1-methylguanidine (PubChem CID 18751924) has the molecular formula C26H23N3 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1,2-bis(1,2-dihydroacenaphthylen-5-yl)-1-methylguanidine.
| Compound Name | 1,2-bis(1,2-dihydroacenaphthylen-5-yl)-1-methylguanidine |
|---|---|
| PubChem CID | 18751924 |
| Molecular Formula | C26H23N3 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1,2-bis(1,2-dihydroacenaphthylen-5-yl)-1-methylguanidine |
| SMILES | CN(/C(N)=N/c1ccc2c3c(cccc13)CC2)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C26H23N3/c1-29(23-15-13-19-11-9-17-5-3-7-21(23)25(17)19)26(27)28-22-14-12-18-10-8-16-4-2-6-20(22)24(16)18/h2-7,12-15H,8-11H2,1H3,(H2,27,28) |
| InChIKey | CZWZIBVTKOWTLH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|