C27H38N2O5S3 — CID 18752525
5-[5-[4-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-4-methylhexyl]sulfinyl-2-methylpentan-2-yl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dione (PubChem CID 18752525) has the molecular formula C27H38N2O5S3 and a molecular weight of 566.81 g/mol. Its IUPAC name is 5-[5-[4-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-4-methylhexyl]sulfinyl-2-methylpentan-2-yl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dione.
| Compound Name | 5-[5-[4-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-4-methylhexyl]sulfinyl-2-methylpentan-2-yl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dione |
|---|---|
| PubChem CID | 18752525 |
| Molecular Formula | C27H38N2O5S3 |
| Molecular Weight | 566.81 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 5-[5-[4-(4,6-dioxo-3,3a-dihydro-2H-thieno[3,2-c]pyridin-5-yl)-4-methylhexyl]sulfinyl-2-methylpentan-2-yl]-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dione |
| SMILES | CCC(C)(CCCS(=O)CCCC(C)(C)N1C(=O)C=C2SCCC2C1=O)N1C(=O)C=C2SCCC2C1=O |
| InChI | InChI=1S/C27H38N2O5S3/c1-5-27(4,29-23(31)17-21-19(25(29)33)9-13-36-21)11-7-15-37(34)14-6-10-26(2,3)28-22(30)16-20-18(24(28)32)8-12-35-20/h16-19H,5-15H2,1-4H3 |
| InChIKey | AHELLHZYYAKEGM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.81 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|