C28H54O4S2 — CID 18752547
6-[6-[2-[6-(6-hydroxy-5,5-dimethylhexyl)-1-oxothian-2-yl]ethyl]-1-oxothian-2-yl]-2,2-dimethylhexan-1-ol (PubChem CID 18752547) has the molecular formula C28H54O4S2 and a molecular weight of 518.87 g/mol. Its IUPAC name is 6-[6-[2-[6-(6-hydroxy-5,5-dimethylhexyl)-1-oxothian-2-yl]ethyl]-1-oxothian-2-yl]-2,2-dimethylhexan-1-ol.
| Compound Name | 6-[6-[2-[6-(6-hydroxy-5,5-dimethylhexyl)-1-oxothian-2-yl]ethyl]-1-oxothian-2-yl]-2,2-dimethylhexan-1-ol |
|---|---|
| PubChem CID | 18752547 |
| Molecular Formula | C28H54O4S2 |
| Molecular Weight | 518.87 g/mol |
| Exact Mass | 518.35 |
| IUPAC Name | 6-[6-[2-[6-(6-hydroxy-5,5-dimethylhexyl)-1-oxothian-2-yl]ethyl]-1-oxothian-2-yl]-2,2-dimethylhexan-1-ol |
| SMILES | CC(C)(CO)CCCCC1CCCC(CCC2CCCC(CCCCC(C)(C)CO)S2=O)S1=O |
| InChI | InChI=1S/C28H54O4S2/c1-27(2,21-29)19-7-5-11-23-13-9-15-25(33(23)31)17-18-26-16-10-14-24(34(26)32)12-6-8-20-28(3,4)22-30/h23-26,29-30H,5-22H2,1-4H3 |
| InChIKey | ADYIUZWEJVFNAD-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.87 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|