About 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol
9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol (PubChem CID 18752749) has the molecular formula C22H46O3S
and a molecular weight of 390.67 g/mol. Its IUPAC name is 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol.
Molecular Properties
| Compound Name | 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol |
| PubChem CID | 18752749 |
| Molecular Formula | C22H46O3S |
| Molecular Weight | 390.67 g/mol |
| Exact Mass | 390.32 |
| IUPAC Name | 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol |
| SMILES | CC(C)(CCCO)CCCCCS(=O)CCCCCC(C)(C)CCCO |
| InChI | InChI=1S/C22H46O3S/c1-21(2,15-11-17-23)13-7-5-9-19-26(25)20-10-6-8-14-22(3,4)16-12-18-24/h23-24H,5-20H2,1-4H3 |
| InChIKey | AOCYWYBEYMXNHD-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol?
The IUPAC name of 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol (CID 18752749) is 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol.
What is the SMILES notation for 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol?
The canonical SMILES for 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol is CC(C)(CCCO)CCCCCS(=O)CCCCCC(C)(C)CCCO.
What is the InChIKey of 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol?
The InChIKey is AOCYWYBEYMXNHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46O3S/c1-21(2,15-11-17-23)13-7-5-9-19-26(25)20-10-6-8-14-22(3,4)16-12-18-24/h23-24H,5-20H2,1-4H3.
What are the key properties of 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol?
9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol has a molecular weight of 390.67 g/mol, XLogP of 5.45, 18 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(9-hydroxy-6,6-dimethylnonyl)sulfinyl-4,4-dimethylnonan-1-ol is sourced from PubChem (CID 18752749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).