About 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid
6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid (PubChem CID 18752759) has the molecular formula C17H32O5S
and a molecular weight of 348.51 g/mol. Its IUPAC name is 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid.
Molecular Properties
| Compound Name | 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid |
| PubChem CID | 18752759 |
| Molecular Formula | C17H32O5S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid |
| SMILES | COC(=O)C(C)(C)CCCCS(=O)CCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C17H32O5S/c1-16(2,14(18)19)10-6-8-12-23(21)13-9-7-11-17(3,4)15(20)22-5/h6-13H2,1-5H3,(H,18,19) |
| InChIKey | PLOFZZFQIAAHRZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid?
The IUPAC name of 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid (CID 18752759) is 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid.
What is the SMILES notation for 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid?
The canonical SMILES for 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid is COC(=O)C(C)(C)CCCCS(=O)CCCCC(C)(C)C(=O)O.
What is the InChIKey of 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid?
The InChIKey is PLOFZZFQIAAHRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32O5S/c1-16(2,14(18)19)10-6-8-12-23(21)13-9-7-11-17(3,4)15(20)22-5/h6-13H2,1-5H3,(H,18,19).
What are the key properties of 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid?
6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid has a molecular weight of 348.51 g/mol, XLogP of 3.39, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-methoxy-5,5-dimethyl-6-oxohexyl)sulfinyl-2,2-dimethylhexanoic acid is sourced from PubChem (CID 18752759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).