C8H6F3NO3 — CID 18752822
2,2,2-Trifluoro-1-(2-nitrophenyl)ethan-1-ol (PubChem CID 18752822) has the molecular formula C8H6F3NO3 and a molecular weight of 221.13 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(2-nitrophenyl)ethanol.
| Compound Name | 2,2,2-Trifluoro-1-(2-nitrophenyl)ethan-1-ol |
|---|---|
| PubChem CID | 18752822 |
| Molecular Formula | C8H6F3NO3 |
| Molecular Weight | 221.13 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | 2,2,2-trifluoro-1-(2-nitrophenyl)ethanol |
| SMILES | C1=CC=C(C(=C1)C(C(F)(F)F)O)[N+](=O)[O-] |
| InChI | InChI=1S/C8H6F3NO3/c9-8(10,11)7(13)5-3-1-2-4-6(5)12(14)15/h1-4,7,13H |
| InChIKey | ABHAFAQMIBXHIR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | 238 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.13 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|