C22H30N2O7 — CID 18753045
diethyl 2-[[2-(hydroxymethyl)-7-(morpholin-4-ylmethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]methylidene]propanedioate (PubChem CID 18753045) has the molecular formula C22H30N2O7 and a molecular weight of 434.49 g/mol. Its IUPAC name is diethyl 2-[[2-(hydroxymethyl)-7-(morpholin-4-ylmethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[2-(hydroxymethyl)-7-(morpholin-4-ylmethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 18753045 |
| Molecular Formula | C22H30N2O7 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | diethyl 2-[[2-(hydroxymethyl)-7-(morpholin-4-ylmethyl)-2,3-dihydro-1,4-benzoxazin-4-yl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN1CC(CO)Oc2cc(CN3CCOCC3)ccc21)C(=O)OCC |
| InChI | InChI=1S/C22H30N2O7/c1-3-29-21(26)18(22(27)30-4-2)14-24-13-17(15-25)31-20-11-16(5-6-19(20)24)12-23-7-9-28-10-8-23/h5-6,11,14,17,25H,3-4,7-10,12-13,15H2,1-2H3 |
| InChIKey | WRZPXFFJURBBTK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|