About 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile
4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile (PubChem CID 18753217) has the molecular formula C9H12ClN5O2
and a molecular weight of 257.68 g/mol. Its IUPAC name is 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile |
| PubChem CID | 18753217 |
| Molecular Formula | C9H12ClN5O2 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(Cl)nc(NCCO)nc1NCCO |
| InChI | InChI=1S/C9H12ClN5O2/c10-7-6(5-11)8(12-1-3-16)15-9(14-7)13-2-4-17/h16-17H,1-4H2,(H2,12,13,14,15) |
| InChIKey | RMFVUDAGEWRNHG-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile?
The IUPAC name of 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile (CID 18753217) is 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile.
What is the SMILES notation for 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile?
The canonical SMILES for 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile is N#Cc1c(Cl)nc(NCCO)nc1NCCO.
What is the InChIKey of 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile?
The InChIKey is RMFVUDAGEWRNHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN5O2/c10-7-6(5-11)8(12-1-3-16)15-9(14-7)13-2-4-17/h16-17H,1-4H2,(H2,12,13,14,15).
What are the key properties of 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile?
4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile has a molecular weight of 257.68 g/mol, XLogP of -0.19, 6 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,6-bis(2-hydroxyethylamino)pyrimidine-5-carbonitrile is sourced from PubChem (CID 18753217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).