About 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal
4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal (PubChem CID 18753377) has the molecular formula C13H14FNO2
and a molecular weight of 235.26 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal.
Molecular Properties
| Compound Name | 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal |
| PubChem CID | 18753377 |
| Molecular Formula | C13H14FNO2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal |
| SMILES | O=CCCCC1CC(c2ccc(F)cc2)=NO1 |
| InChI | InChI=1S/C13H14FNO2/c14-11-6-4-10(5-7-11)13-9-12(17-15-13)3-1-2-8-16/h4-8,12H,1-3,9H2 |
| InChIKey | KTTNTRMHZWRBLI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal?
The IUPAC name of 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal (CID 18753377) is 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal.
What is the SMILES notation for 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal?
The canonical SMILES for 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal is O=CCCCC1CC(c2ccc(F)cc2)=NO1.
What is the InChIKey of 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal?
The InChIKey is KTTNTRMHZWRBLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14FNO2/c14-11-6-4-10(5-7-11)13-9-12(17-15-13)3-1-2-8-16/h4-8,12H,1-3,9H2.
What are the key properties of 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal?
4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal has a molecular weight of 235.26 g/mol, XLogP of 2.69, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]butanal is sourced from PubChem (CID 18753377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).