About 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal
3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal (PubChem CID 18753380) has the molecular formula C12H12FNO2
and a molecular weight of 221.23 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal.
Molecular Properties
| Compound Name | 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal |
| PubChem CID | 18753380 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal |
| SMILES | O=CCCC1CC(c2ccc(F)cc2)=NO1 |
| InChI | InChI=1S/C12H12FNO2/c13-10-5-3-9(4-6-10)12-8-11(16-14-12)2-1-7-15/h3-7,11H,1-2,8H2 |
| InChIKey | LRLGMKUBYBYXHS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal?
The IUPAC name of 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal (CID 18753380) is 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal.
What is the SMILES notation for 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal?
The canonical SMILES for 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal is O=CCCC1CC(c2ccc(F)cc2)=NO1.
What is the InChIKey of 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal?
The InChIKey is LRLGMKUBYBYXHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO2/c13-10-5-3-9(4-6-10)12-8-11(16-14-12)2-1-7-15/h3-7,11H,1-2,8H2.
What are the key properties of 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal?
3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal has a molecular weight of 221.23 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(4-fluorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]propanal is sourced from PubChem (CID 18753380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).