C16H24N2O5Si — CID 18753664
6,7-dimethoxy-1-(2-trimethylsilylethoxymethyl)quinazoline-2,4-dione (PubChem CID 18753664) has the molecular formula C16H24N2O5Si and a molecular weight of 352.46 g/mol. Its IUPAC name is 6,7-dimethoxy-1-(2-trimethylsilylethoxymethyl)quinazoline-2,4-dione.
| Compound Name | 6,7-dimethoxy-1-(2-trimethylsilylethoxymethyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 18753664 |
| Molecular Formula | C16H24N2O5Si |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 6,7-dimethoxy-1-(2-trimethylsilylethoxymethyl)quinazoline-2,4-dione |
| SMILES | COc1cc2c(=O)[nH]c(=O)n(COCC[Si](C)(C)C)c2cc1OC |
| InChI | InChI=1S/C16H24N2O5Si/c1-21-13-8-11-12(9-14(13)22-2)18(16(20)17-15(11)19)10-23-6-7-24(3,4)5/h8-9H,6-7,10H2,1-5H3,(H,17,19,20) |
| InChIKey | JPFFLMYJDHOQJT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|