C27H25N5O2 — CID 18754092
1-[4-[2-[(dimethylamino)methyl]phenyl]phenyl]-7-(4-methoxyphenyl)purin-6-one (PubChem CID 18754092) has the molecular formula C27H25N5O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is 1-[4-[2-[(dimethylamino)methyl]phenyl]phenyl]-7-(4-methoxyphenyl)purin-6-one.
| Compound Name | 1-[4-[2-[(dimethylamino)methyl]phenyl]phenyl]-7-(4-methoxyphenyl)purin-6-one |
|---|---|
| PubChem CID | 18754092 |
| Molecular Formula | C27H25N5O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | 1-[4-[2-[(dimethylamino)methyl]phenyl]phenyl]-7-(4-methoxyphenyl)purin-6-one |
| SMILES | COc1ccc(-n2cnc3ncn(-c4ccc(-c5ccccc5CN(C)C)cc4)c(=O)c32)cc1 |
| InChI | InChI=1S/C27H25N5O2/c1-30(2)16-20-6-4-5-7-24(20)19-8-10-22(11-9-19)32-18-29-26-25(27(32)33)31(17-28-26)21-12-14-23(34-3)15-13-21/h4-15,17-18H,16H2,1-3H3 |
| InChIKey | YMLKPZMJOXIOHO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |