C8H5Cl2N3O2 — CID 18755009
4-(3,5-dichlorophenyl)-1,2,4-triazolidine-3,5-dione (PubChem CID 18755009) has the molecular formula C8H5Cl2N3O2 and a molecular weight of 246.05 g/mol. Its IUPAC name is 4-(3,5-dichlorophenyl)-1,2,4-triazolidine-3,5-dione.
| Compound Name | 4-(3,5-dichlorophenyl)-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 18755009 |
| Molecular Formula | C8H5Cl2N3O2 |
| Molecular Weight | 246.05 g/mol |
| Exact Mass | 244.98 |
| IUPAC Name | 4-(3,5-dichlorophenyl)-1,2,4-triazolidine-3,5-dione |
| SMILES | O=c1[nH][nH]c(=O)n1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C8H5Cl2N3O2/c9-4-1-5(10)3-6(2-4)13-7(14)11-12-8(13)15/h1-3H,(H,11,14)(H,12,15) |
| InChIKey | HCQSIVSKXQMCIF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.05 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |