C20H18 — CID 18755049
1,2,3,3a,4,5-hexahydroperylene (PubChem CID 18755049) has the molecular formula C20H18 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1,2,3,3a,4,5-hexahydroperylene.
| Compound Name | 1,2,3,3a,4,5-hexahydroperylene |
|---|---|
| PubChem CID | 18755049 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1,2,3,3a,4,5-hexahydroperylene |
| SMILES | C1=c2c3c(c4cccc5cccc2c54)CCCC3CC1 |
| InChI | InChI=1S/C20H18/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17/h1-2,5-6,9-11,14H,3-4,7-8,12H2 |
| InChIKey | IIGJDAOTDUESSU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |