C10H6F12 — CID 18755105
3-ethenyl-3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-1-ene (PubChem CID 18755105) has the molecular formula C10H6F12 and a molecular weight of 354.13 g/mol. Its IUPAC name is 3-ethenyl-3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-1-ene.
| Compound Name | 3-ethenyl-3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-1-ene |
|---|---|
| PubChem CID | 18755105 |
| Molecular Formula | C10H6F12 |
| Molecular Weight | 354.13 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 3-ethenyl-3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-1-ene |
| SMILES | C=CC(F)(C=C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F12/c1-3-5(11,4-2)6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)22/h3-4H,1-2H2 |
| InChIKey | BJXWZNKCYRQOJF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.13 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|