About 2,3-dimethyloxetane
2,3-dimethyloxetane (PubChem CID 18755630) has the molecular formula C5H10O
and a molecular weight of 86.13 g/mol. Its IUPAC name is 2,3-dimethyloxetane.
Molecular Properties
| Compound Name | 2,3-dimethyloxetane |
| PubChem CID | 18755630 |
| Molecular Formula | C5H10O |
| Molecular Weight | 86.13 g/mol |
| Exact Mass | 86.07 |
| IUPAC Name | 2,3-dimethyloxetane |
| SMILES | CC1COC1C |
| InChI | InChI=1S/C5H10O/c1-4-3-6-5(4)2/h4-5H,3H2,1-2H3 |
| InChIKey | CIPFOSRMMVMZPR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.13 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethyloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyloxetane?
The IUPAC name of 2,3-dimethyloxetane (CID 18755630) is 2,3-dimethyloxetane.
What is the SMILES notation for 2,3-dimethyloxetane?
The canonical SMILES for 2,3-dimethyloxetane is CC1COC1C.
What is the InChIKey of 2,3-dimethyloxetane?
The InChIKey is CIPFOSRMMVMZPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O/c1-4-3-6-5(4)2/h4-5H,3H2,1-2H3.
What are the key properties of 2,3-dimethyloxetane?
2,3-dimethyloxetane has a molecular weight of 86.13 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyloxetane is sourced from PubChem (CID 18755630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).