About 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide
2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide (PubChem CID 18755844) has the molecular formula C10H8N2O4S
and a molecular weight of 252.25 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide |
| PubChem CID | 18755844 |
| Molecular Formula | C10H8N2O4S |
| Molecular Weight | 252.25 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccccc1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C10H8N2O4S/c11-17(15,16)8-4-2-1-3-7(8)12-9(13)5-6-10(12)14/h1-6H,(H2,11,15,16) |
| InChIKey | PFQRIHGCFHCSDJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.25 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide?
The IUPAC name of 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide (CID 18755844) is 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide.
What is the SMILES notation for 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide?
The canonical SMILES for 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide is NS(=O)(=O)c1ccccc1N1C(=O)C=CC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide?
The InChIKey is PFQRIHGCFHCSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O4S/c11-17(15,16)8-4-2-1-3-7(8)12-9(13)5-6-10(12)14/h1-6H,(H2,11,15,16).
What are the key properties of 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide?
2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide has a molecular weight of 252.25 g/mol, XLogP of -0.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrol-1-yl)benzenesulfonamide is sourced from PubChem (CID 18755844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).