C22H24F4N6O3 — CID 18756136
N-[[6-[3-(dimethylamino)propoxy]-1,3-dimethylpyrazolo[3,4-b]pyridin-5-yl]carbamoyl]-N-[4-fluoro-3-(trifluoromethyl)phenyl]formamide (PubChem CID 18756136) has the molecular formula C22H24F4N6O3 and a molecular weight of 496.47 g/mol. Its IUPAC name is N-[[6-[3-(dimethylamino)propoxy]-1,3-dimethylpyrazolo[3,4-b]pyridin-5-yl]carbamoyl]-N-[4-fluoro-3-(trifluoromethyl)phenyl]formamide.
| Compound Name | N-[[6-[3-(dimethylamino)propoxy]-1,3-dimethylpyrazolo[3,4-b]pyridin-5-yl]carbamoyl]-N-[4-fluoro-3-(trifluoromethyl)phenyl]formamide |
|---|---|
| PubChem CID | 18756136 |
| Molecular Formula | C22H24F4N6O3 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N-[[6-[3-(dimethylamino)propoxy]-1,3-dimethylpyrazolo[3,4-b]pyridin-5-yl]carbamoyl]-N-[4-fluoro-3-(trifluoromethyl)phenyl]formamide |
| SMILES | Cc1nn(C)c2nc(OCCCN(C)C)c(NC(=O)N(C=O)c3ccc(F)c(C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C22H24F4N6O3/c1-13-15-11-18(20(28-19(15)31(4)29-13)35-9-5-8-30(2)3)27-21(34)32(12-33)14-6-7-17(23)16(10-14)22(24,25)26/h6-7,10-12H,5,8-9H2,1-4H3,(H,27,34) |
| InChIKey | PYMIISWCXFPKRD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|