About 5-sulfonylcyclohexa-1,3-diene
5-sulfonylcyclohexa-1,3-diene (PubChem CID 18756164) has the molecular formula C6H6O2S
and a molecular weight of 142.18 g/mol. Its IUPAC name is 5-sulfonylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-sulfonylcyclohexa-1,3-diene |
| PubChem CID | 18756164 |
| Molecular Formula | C6H6O2S |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.01 |
| IUPAC Name | 5-sulfonylcyclohexa-1,3-diene |
| SMILES | O=S(=O)=C1C=CC=CC1 |
| InChI | InChI=1S/C6H6O2S/c7-9(8)6-4-2-1-3-5-6/h1-4H,5H2 |
| InChIKey | VTILWYBQQRECER-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-sulfonylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-sulfonylcyclohexa-1,3-diene?
The IUPAC name of 5-sulfonylcyclohexa-1,3-diene (CID 18756164) is 5-sulfonylcyclohexa-1,3-diene.
What is the SMILES notation for 5-sulfonylcyclohexa-1,3-diene?
The canonical SMILES for 5-sulfonylcyclohexa-1,3-diene is O=S(=O)=C1C=CC=CC1.
What is the InChIKey of 5-sulfonylcyclohexa-1,3-diene?
The InChIKey is VTILWYBQQRECER-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2S/c7-9(8)6-4-2-1-3-5-6/h1-4H,5H2.
What are the key properties of 5-sulfonylcyclohexa-1,3-diene?
5-sulfonylcyclohexa-1,3-diene has a molecular weight of 142.18 g/mol, XLogP of 0.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-sulfonylcyclohexa-1,3-diene is sourced from PubChem (CID 18756164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).