C15H17FO3 — CID 18756309
methyl 3-(4-fluorophenyl)-8-oxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 18756309) has the molecular formula C15H17FO3 and a molecular weight of 264.30 g/mol. Its IUPAC name is methyl 3-(4-fluorophenyl)-8-oxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl 3-(4-fluorophenyl)-8-oxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 18756309 |
| Molecular Formula | C15H17FO3 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | methyl 3-(4-fluorophenyl)-8-oxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)C1C2CCC(CC1c1ccc(F)cc1)O2 |
| InChI | InChI=1S/C15H17FO3/c1-18-15(17)14-12(8-11-6-7-13(14)19-11)9-2-4-10(16)5-3-9/h2-5,11-14H,6-8H2,1H3 |
| InChIKey | UNNABHWRKRTYKT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |