C43H58O12P2S4 — CID 18757139
2-[4-[3-[bis[4-(2-sulfophenyl)butyl]phosphanyl]propyl-[4-(2-sulfophenyl)butyl]phosphanyl]butyl]benzenesulfonic acid (PubChem CID 18757139) has the molecular formula C43H58O12P2S4 and a molecular weight of 957.14 g/mol. Its IUPAC name is 2-[4-[3-[bis[4-(2-sulfophenyl)butyl]phosphanyl]propyl-[4-(2-sulfophenyl)butyl]phosphanyl]butyl]benzenesulfonic acid.
| Compound Name | 2-[4-[3-[bis[4-(2-sulfophenyl)butyl]phosphanyl]propyl-[4-(2-sulfophenyl)butyl]phosphanyl]butyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 18757139 |
| Molecular Formula | C43H58O12P2S4 |
| Molecular Weight | 957.14 g/mol |
| Exact Mass | 956.23 |
| IUPAC Name | 2-[4-[3-[bis[4-(2-sulfophenyl)butyl]phosphanyl]propyl-[4-(2-sulfophenyl)butyl]phosphanyl]butyl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccccc1CCCCP(CCCCc1ccccc1S(=O)(=O)O)CCCP(CCCCc1ccccc1S(=O)(=O)O)CCCCc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C43H58O12P2S4/c44-58(45,46)40-26-5-1-18-36(40)22-9-13-30-56(31-14-10-23-37-19-2-6-27-41(37)59(47,48)49)34-17-35-57(32-15-11-24-38-20-3-7-28-42(38)60(50,51)52)33-16-12-25-39-21-4-8-29-43(39)61(53,54)55/h1-8,18-21,26-29H,9-17,22-25,30-35H2,(H,44,45,46)(H,47,48,49)(H,50,51,52)(H,53,54,55) |
| InChIKey | LULWOKJQTMPSRC-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 217.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.14 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|