C9H11BrS — CID 18757276
1-bromo-2,3-dimethyl-4-methylsulfanylbenzene (PubChem CID 18757276) has the molecular formula C9H11BrS and a molecular weight of 231.16 g/mol. Its IUPAC name is 1-bromo-2,3-dimethyl-4-methylsulfanylbenzene.
| Compound Name | 1-bromo-2,3-dimethyl-4-methylsulfanylbenzene |
|---|---|
| PubChem CID | 18757276 |
| Molecular Formula | C9H11BrS |
| Molecular Weight | 231.16 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | 1-bromo-2,3-dimethyl-4-methylsulfanylbenzene |
| SMILES | CSc1ccc(Br)c(C)c1C |
| InChI | InChI=1S/C9H11BrS/c1-6-7(2)9(11-3)5-4-8(6)10/h4-5H,1-3H3 |
| InChIKey | BKSDMXBOYOULTG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |