About 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine
3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine (PubChem CID 18757549) has the molecular formula C10H10N6
and a molecular weight of 214.23 g/mol. Its IUPAC name is 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine.
Molecular Properties
| Compound Name | 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine |
| PubChem CID | 18757549 |
| Molecular Formula | C10H10N6 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine |
| SMILES | Nc1ccnc(N)c1/N=N/c1cccnc1 |
| InChI | InChI=1S/C10H10N6/c11-8-3-5-14-10(12)9(8)16-15-7-2-1-4-13-6-7/h1-6H,(H4,11,12,14)/b16-15+ |
| InChIKey | CTUZRZQEPKAVEI-FOCLMDBBSA-N |
| XLogP | 2.06 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine?
The IUPAC name of 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine (CID 18757549) is 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine.
What is the SMILES notation for 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine?
The canonical SMILES for 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine is Nc1ccnc(N)c1/N=N/c1cccnc1.
What is the InChIKey of 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine?
The InChIKey is CTUZRZQEPKAVEI-FOCLMDBBSA-N. The full InChI is InChI=1S/C10H10N6/c11-8-3-5-14-10(12)9(8)16-15-7-2-1-4-13-6-7/h1-6H,(H4,11,12,14)/b16-15+.
What are the key properties of 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine?
3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine has a molecular weight of 214.23 g/mol, XLogP of 2.06, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(pyridin-3-yldiazenyl)pyridine-2,4-diamine is sourced from PubChem (CID 18757549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).