About 3,5-dimethylheptan-4-amine
3,5-dimethylheptan-4-amine (PubChem CID 18757614) has the molecular formula C9H21N
and a molecular weight of 143.27 g/mol. Its IUPAC name is 3,5-dimethylheptan-4-amine.
Molecular Properties
| Compound Name | 3,5-dimethylheptan-4-amine |
| PubChem CID | 18757614 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | 3,5-dimethylheptan-4-amine |
| SMILES | CCC(C)C(N)C(C)CC |
| InChI | InChI=1S/C9H21N/c1-5-7(3)9(10)8(4)6-2/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | NQCIHPGUHDUFRE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dimethylheptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethylheptan-4-amine?
The IUPAC name of 3,5-dimethylheptan-4-amine (CID 18757614) is 3,5-dimethylheptan-4-amine.
What is the SMILES notation for 3,5-dimethylheptan-4-amine?
The canonical SMILES for 3,5-dimethylheptan-4-amine is CCC(C)C(N)C(C)CC.
What is the InChIKey of 3,5-dimethylheptan-4-amine?
The InChIKey is NQCIHPGUHDUFRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N/c1-5-7(3)9(10)8(4)6-2/h7-9H,5-6,10H2,1-4H3.
What are the key properties of 3,5-dimethylheptan-4-amine?
3,5-dimethylheptan-4-amine has a molecular weight of 143.27 g/mol, XLogP of 2.41, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylheptan-4-amine is sourced from PubChem (CID 18757614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).