About 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one
2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one (PubChem CID 18757976) has the molecular formula C30H44N2O
and a molecular weight of 448.70 g/mol. Its IUPAC name is 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one.
Molecular Properties
| Compound Name | 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one |
| PubChem CID | 18757976 |
| Molecular Formula | C30H44N2O |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.35 |
| IUPAC Name | 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one |
| SMILES | CCCCCN1CCCN(c2ccc3c4c(cccc24)C(=O)C3(CCCC)CCCC)CC1 |
| InChI | InChI=1S/C30H44N2O/c1-4-7-10-19-31-20-12-21-32(23-22-31)27-16-15-26-28-24(27)13-11-14-25(28)29(33)30(26,17-8-5-2)18-9-6-3/h11,13-16H,4-10,12,17-23H2,1-3H3 |
| InChIKey | RBGJVFIIXGXCNN-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one?
The IUPAC name of 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one (CID 18757976) is 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one.
What is the SMILES notation for 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one?
The canonical SMILES for 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one is CCCCCN1CCCN(c2ccc3c4c(cccc24)C(=O)C3(CCCC)CCCC)CC1.
What is the InChIKey of 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one?
The InChIKey is RBGJVFIIXGXCNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H44N2O/c1-4-7-10-19-31-20-12-21-32(23-22-31)27-16-15-26-28-24(27)13-11-14-25(28)29(33)30(26,17-8-5-2)18-9-6-3/h11,13-16H,4-10,12,17-23H2,1-3H3.
What are the key properties of 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one?
2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one has a molecular weight of 448.70 g/mol, XLogP of 7.36, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibutyl-5-(4-pentyl-1,4-diazepan-1-yl)acenaphthylen-1-one is sourced from PubChem (CID 18757976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).