C42H80N2O6 — CID 18758835
2,2-bis(1-heptoxy-2,2,6,6-tetramethylpiperidin-4-yl)decanedioic acid (PubChem CID 18758835) has the molecular formula C42H80N2O6 and a molecular weight of 709.11 g/mol. Its IUPAC name is 2,2-bis(1-heptoxy-2,2,6,6-tetramethylpiperidin-4-yl)decanedioic acid.
| Compound Name | 2,2-bis(1-heptoxy-2,2,6,6-tetramethylpiperidin-4-yl)decanedioic acid |
|---|---|
| PubChem CID | 18758835 |
| Molecular Formula | C42H80N2O6 |
| Molecular Weight | 709.11 g/mol |
| Exact Mass | 708.60 |
| IUPAC Name | 2,2-bis(1-heptoxy-2,2,6,6-tetramethylpiperidin-4-yl)decanedioic acid |
| SMILES | CCCCCCCON1C(C)(C)CC(C(CCCCCCCC(=O)O)(C(=O)O)C2CC(C)(C)N(OCCCCCCC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C42H80N2O6/c1-11-13-15-20-24-28-49-43-38(3,4)30-34(31-39(43,5)6)42(37(47)48,27-23-19-17-18-22-26-36(45)46)35-32-40(7,8)44(41(9,10)33-35)50-29-25-21-16-14-12-2/h34-35H,11-33H2,1-10H3,(H,45,46)(H,47,48) |
| InChIKey | MCBFVQDPOXFPSM-UHFFFAOYSA-N |
| XLogP | 11.22 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.11 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|