About 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride
4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride (PubChem CID 18758859) has the molecular formula C8H13Cl2NS
and a molecular weight of 226.17 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride |
| PubChem CID | 18758859 |
| Molecular Formula | C8H13Cl2NS |
| Molecular Weight | 226.17 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride |
| SMILES | CC(C)Cc1nc(CCl)cs1.Cl |
| InChI | InChI=1S/C8H12ClNS.ClH/c1-6(2)3-8-10-7(4-9)5-11-8;/h5-6H,3-4H2,1-2H3;1H |
| InChIKey | DPAKNEZBGFAUSK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.17 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride?
The IUPAC name of 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride (CID 18758859) is 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride.
What is the SMILES notation for 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride?
The canonical SMILES for 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride is CC(C)Cc1nc(CCl)cs1.Cl.
What is the InChIKey of 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride?
The InChIKey is DPAKNEZBGFAUSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClNS.ClH/c1-6(2)3-8-10-7(4-9)5-11-8;/h5-6H,3-4H2,1-2H3;1H.
What are the key properties of 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride?
4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride has a molecular weight of 226.17 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2-(2-methylpropyl)-1,3-thiazole;hydrochloride is sourced from PubChem (CID 18758859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).