About 2-(oxiran-2-yl)oxolane
2-(oxiran-2-yl)oxolane (PubChem CID 18759351) has the molecular formula C6H10O2
and a molecular weight of 114.14 g/mol. Its IUPAC name is 2-(oxiran-2-yl)oxolane.
Molecular Properties
| Compound Name | 2-(oxiran-2-yl)oxolane |
| PubChem CID | 18759351 |
| Molecular Formula | C6H10O2 |
| Molecular Weight | 114.14 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | 2-(oxiran-2-yl)oxolane |
| SMILES | C1COC(C2CO2)C1 |
| InChI | InChI=1S/C6H10O2/c1-2-5(7-3-1)6-4-8-6/h5-6H,1-4H2 |
| InChIKey | VONIIIGNMROHOI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.14 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-yl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-yl)oxolane?
The IUPAC name of 2-(oxiran-2-yl)oxolane (CID 18759351) is 2-(oxiran-2-yl)oxolane.
What is the SMILES notation for 2-(oxiran-2-yl)oxolane?
The canonical SMILES for 2-(oxiran-2-yl)oxolane is C1COC(C2CO2)C1.
What is the InChIKey of 2-(oxiran-2-yl)oxolane?
The InChIKey is VONIIIGNMROHOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2/c1-2-5(7-3-1)6-4-8-6/h5-6H,1-4H2.
What are the key properties of 2-(oxiran-2-yl)oxolane?
2-(oxiran-2-yl)oxolane has a molecular weight of 114.14 g/mol, XLogP of 0.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-yl)oxolane is sourced from PubChem (CID 18759351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).