C15H16F6N2 — CID 18759354
azane;(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)benzene (PubChem CID 18759354) has the molecular formula C15H16F6N2 and a molecular weight of 338.30 g/mol. Its IUPAC name is azane;(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)benzene.
| Compound Name | azane;(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)benzene |
|---|---|
| PubChem CID | 18759354 |
| Molecular Formula | C15H16F6N2 |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | azane;(1,1,1,3,3,3-hexafluoro-2-phenylpropan-2-yl)benzene |
| SMILES | FC(F)(F)C(c1ccccc1)(c1ccccc1)C(F)(F)F.N.N |
| InChI | InChI=1S/C15H10F6.2H3N/c16-14(17,18)13(15(19,20)21,11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-10H;2*1H3 |
| InChIKey | KWQUDRBSBDUHHF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |