About azane;1,2-diphenoxybenzene
azane;1,2-diphenoxybenzene (PubChem CID 18759355) has the molecular formula C18H20N2O2
and a molecular weight of 296.37 g/mol. Its IUPAC name is azane;1,2-diphenoxybenzene.
Molecular Properties
| Compound Name | azane;1,2-diphenoxybenzene |
| PubChem CID | 18759355 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | azane;1,2-diphenoxybenzene |
| SMILES | N.N.c1ccc(Oc2ccccc2Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H14O2.2H3N/c1-3-9-15(10-4-1)19-17-13-7-8-14-18(17)20-16-11-5-2-6-12-16;;/h1-14H;2*1H3 |
| InChIKey | JETDJSFRVOUWJR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;1,2-diphenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,2-diphenoxybenzene?
The IUPAC name of azane;1,2-diphenoxybenzene (CID 18759355) is azane;1,2-diphenoxybenzene.
What is the SMILES notation for azane;1,2-diphenoxybenzene?
The canonical SMILES for azane;1,2-diphenoxybenzene is N.N.c1ccc(Oc2ccccc2Oc2ccccc2)cc1.
What is the InChIKey of azane;1,2-diphenoxybenzene?
The InChIKey is JETDJSFRVOUWJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O2.2H3N/c1-3-9-15(10-4-1)19-17-13-7-8-14-18(17)20-16-11-5-2-6-12-16;;/h1-14H;2*1H3.
What are the key properties of azane;1,2-diphenoxybenzene?
azane;1,2-diphenoxybenzene has a molecular weight of 296.37 g/mol, XLogP of 5.60, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,2-diphenoxybenzene is sourced from PubChem (CID 18759355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).