C9H10N+ — CID 18759385
1,2,3,4,5-pentamethylidenepyrrolidin-1-ium (PubChem CID 18759385) has the molecular formula C9H10N+ and a molecular weight of 132.19 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethylidenepyrrolidin-1-ium.
| Compound Name | 1,2,3,4,5-pentamethylidenepyrrolidin-1-ium |
|---|---|
| PubChem CID | 18759385 |
| Molecular Formula | C9H10N+ |
| Molecular Weight | 132.19 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 1,2,3,4,5-pentamethylidenepyrrolidin-1-ium |
| SMILES | C=C1C(=C)C(=C)[N+](=C)C1=C |
| InChI | InChI=1S/C9H10N/c1-6-7(2)9(4)10(5)8(6)3/h1-5H2/q+1 |
| InChIKey | IXTPCKFZLDNYCX-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|