About 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium
1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium (PubChem CID 18759389) has the molecular formula C5H11N2+
and a molecular weight of 99.16 g/mol. Its IUPAC name is 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium.
Molecular Properties
| Compound Name | 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium |
| PubChem CID | 18759389 |
| Molecular Formula | C5H11N2+ |
| Molecular Weight | 99.16 g/mol |
| Exact Mass | 99.09 |
| IUPAC Name | 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium |
| SMILES | CC1=NCC[NH+]1C |
| InChI | InChI=1S/C5H10N2/c1-5-6-3-4-7(5)2/h3-4H2,1-2H3/p+1 |
| InChIKey | QEIHVTKMBYEXPZ-UHFFFAOYSA-O |
| XLogP | -1.07 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.16 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium?
The IUPAC name of 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium (CID 18759389) is 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium.
What is the SMILES notation for 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium?
The canonical SMILES for 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium is CC1=NCC[NH+]1C.
What is the InChIKey of 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium?
The InChIKey is QEIHVTKMBYEXPZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H10N2/c1-5-6-3-4-7(5)2/h3-4H2,1-2H3/p+1.
What are the key properties of 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium?
1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium has a molecular weight of 99.16 g/mol, XLogP of -1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-4,5-dihydro-1H-imidazol-1-ium is sourced from PubChem (CID 18759389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).