About N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine
N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine (PubChem CID 18759995) has the molecular formula C27H25F2N3O2
and a molecular weight of 461.51 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine.
Molecular Properties
| Compound Name | N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine |
| PubChem CID | 18759995 |
| Molecular Formula | C27H25F2N3O2 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine |
| SMILES | CCCN(c1cc(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)nn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C27H25F2N3O2/c1-4-15-32(25-14-9-20(28)16-24(25)29)26-17-23(18-5-10-21(33-2)11-6-18)27(31-30-26)19-7-12-22(34-3)13-8-19/h5-14,16-17H,4,15H2,1-3H3 |
| InChIKey | WIIXTMBPNGPCMS-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine?
The IUPAC name of N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine (CID 18759995) is N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine.
What is the SMILES notation for N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine?
The canonical SMILES for N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine is CCCN(c1cc(-c2ccc(OC)cc2)c(-c2ccc(OC)cc2)nn1)c1ccc(F)cc1F.
What is the InChIKey of N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine?
The InChIKey is WIIXTMBPNGPCMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25F2N3O2/c1-4-15-32(25-14-9-20(28)16-24(25)29)26-17-23(18-5-10-21(33-2)11-6-18)27(31-30-26)19-7-12-22(34-3)13-8-19/h5-14,16-17H,4,15H2,1-3H3.
What are the key properties of N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine?
N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine has a molecular weight of 461.51 g/mol, XLogP of 6.65, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-difluorophenyl)-5,6-bis(4-methoxyphenyl)-N-propylpyridazin-3-amine is sourced from PubChem (CID 18759995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).