About N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine
N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine (PubChem CID 18760036) has the molecular formula C25H23N3O2
and a molecular weight of 397.48 g/mol. Its IUPAC name is N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine.
Molecular Properties
| Compound Name | N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine |
| PubChem CID | 18760036 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine |
| SMILES | COc1ccc(-c2cc(NCc3ccccc3)nnc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H23N3O2/c1-29-21-12-8-19(9-13-21)23-16-24(26-17-18-6-4-3-5-7-18)27-28-25(23)20-10-14-22(30-2)15-11-20/h3-16H,17H2,1-2H3,(H,26,27) |
| InChIKey | KCYRAZQCPBFESI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine?
The IUPAC name of N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine (CID 18760036) is N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine.
What is the SMILES notation for N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine?
The canonical SMILES for N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine is COc1ccc(-c2cc(NCc3ccccc3)nnc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine?
The InChIKey is KCYRAZQCPBFESI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23N3O2/c1-29-21-12-8-19(9-13-21)23-16-24(26-17-18-6-4-3-5-7-18)27-28-25(23)20-10-14-22(30-2)15-11-20/h3-16H,17H2,1-2H3,(H,26,27).
What are the key properties of N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine?
N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine has a molecular weight of 397.48 g/mol, XLogP of 5.44, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5,6-bis(4-methoxyphenyl)pyridazin-3-amine is sourced from PubChem (CID 18760036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).