About 2,3-diaminonaphthalen-1-ol
2,3-diaminonaphthalen-1-ol (PubChem CID 18760386) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 2,3-diaminonaphthalen-1-ol.
Molecular Properties
| Compound Name | 2,3-diaminonaphthalen-1-ol |
| PubChem CID | 18760386 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 2,3-diaminonaphthalen-1-ol |
| SMILES | Nc1cc2ccccc2c(O)c1N |
| InChI | InChI=1S/C10H10N2O/c11-8-5-6-3-1-2-4-7(6)10(13)9(8)12/h1-5,13H,11-12H2 |
| InChIKey | VCPMTKKWBCDKNB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2,3-diaminonaphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diaminonaphthalen-1-ol?
The IUPAC name of 2,3-diaminonaphthalen-1-ol (CID 18760386) is 2,3-diaminonaphthalen-1-ol.
What is the SMILES notation for 2,3-diaminonaphthalen-1-ol?
The canonical SMILES for 2,3-diaminonaphthalen-1-ol is Nc1cc2ccccc2c(O)c1N.
What is the InChIKey of 2,3-diaminonaphthalen-1-ol?
The InChIKey is VCPMTKKWBCDKNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c11-8-5-6-3-1-2-4-7(6)10(13)9(8)12/h1-5,13H,11-12H2.
What are the key properties of 2,3-diaminonaphthalen-1-ol?
2,3-diaminonaphthalen-1-ol has a molecular weight of 174.20 g/mol, XLogP of 1.71, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diaminonaphthalen-1-ol is sourced from PubChem (CID 18760386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).