About 3-hexyl-1H-pyridin-2-one
3-hexyl-1H-pyridin-2-one (PubChem CID 18760458) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 3-hexyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3-hexyl-1H-pyridin-2-one |
| PubChem CID | 18760458 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 3-hexyl-1H-pyridin-2-one |
| SMILES | CCCCCCc1ccc[nH]c1=O |
| InChI | InChI=1S/C11H17NO/c1-2-3-4-5-7-10-8-6-9-12-11(10)13/h6,8-9H,2-5,7H2,1H3,(H,12,13) |
| InChIKey | HWDSLXQDXOEFIO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hexyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexyl-1H-pyridin-2-one?
The IUPAC name of 3-hexyl-1H-pyridin-2-one (CID 18760458) is 3-hexyl-1H-pyridin-2-one.
What is the SMILES notation for 3-hexyl-1H-pyridin-2-one?
The canonical SMILES for 3-hexyl-1H-pyridin-2-one is CCCCCCc1ccc[nH]c1=O.
What is the InChIKey of 3-hexyl-1H-pyridin-2-one?
The InChIKey is HWDSLXQDXOEFIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c1-2-3-4-5-7-10-8-6-9-12-11(10)13/h6,8-9H,2-5,7H2,1H3,(H,12,13).
What are the key properties of 3-hexyl-1H-pyridin-2-one?
3-hexyl-1H-pyridin-2-one has a molecular weight of 179.26 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexyl-1H-pyridin-2-one is sourced from PubChem (CID 18760458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).