About 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one
1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one (PubChem CID 18760470) has the molecular formula C15H30N2O2
and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one.
Molecular Properties
| Compound Name | 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one |
| PubChem CID | 18760470 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one |
| SMILES | CC(C)CC1(C)C(=O)N(C(C)(C)C)CC(C)(C)N1O |
| InChI | InChI=1S/C15H30N2O2/c1-11(2)9-15(8)12(18)16(13(3,4)5)10-14(6,7)17(15)19/h11,19H,9-10H2,1-8H3 |
| InChIKey | FLVAVOAZDXIKRC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one?
The IUPAC name of 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one (CID 18760470) is 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one.
What is the SMILES notation for 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one?
The canonical SMILES for 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one is CC(C)CC1(C)C(=O)N(C(C)(C)C)CC(C)(C)N1O.
What is the InChIKey of 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one?
The InChIKey is FLVAVOAZDXIKRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O2/c1-11(2)9-15(8)12(18)16(13(3,4)5)10-14(6,7)17(15)19/h11,19H,9-10H2,1-8H3.
What are the key properties of 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one?
1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one has a molecular weight of 270.42 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-hydroxy-3,5,5-trimethyl-3-(2-methylpropyl)piperazin-2-one is sourced from PubChem (CID 18760470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).