About 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile
2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile (PubChem CID 18760488) has the molecular formula C18H33N3O2
and a molecular weight of 323.48 g/mol. Its IUPAC name is 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile.
Molecular Properties
| Compound Name | 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile |
| PubChem CID | 18760488 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile |
| SMILES | CCC1(CC)C(=O)N(C(C)(C)C)CC(C)(C)N1OC(C)(C)C#N |
| InChI | InChI=1S/C18H33N3O2/c1-10-18(11-2)14(22)20(15(3,4)5)13-16(6,7)21(18)23-17(8,9)12-19/h10-11,13H2,1-9H3 |
| InChIKey | ZLSULMZGWDODMA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile?
The IUPAC name of 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile (CID 18760488) is 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile.
What is the SMILES notation for 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile?
The canonical SMILES for 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile is CCC1(CC)C(=O)N(C(C)(C)C)CC(C)(C)N1OC(C)(C)C#N.
What is the InChIKey of 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile?
The InChIKey is ZLSULMZGWDODMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33N3O2/c1-10-18(11-2)14(22)20(15(3,4)5)13-16(6,7)21(18)23-17(8,9)12-19/h10-11,13H2,1-9H3.
What are the key properties of 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile?
2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile has a molecular weight of 323.48 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-tert-butyl-2,2-diethyl-6,6-dimethyl-3-oxopiperazin-1-yl)oxy-2-methylpropanenitrile is sourced from PubChem (CID 18760488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).