About (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate
(5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate (PubChem CID 18760490) has the molecular formula C15H27NO4
and a molecular weight of 285.38 g/mol. Its IUPAC name is (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate |
| PubChem CID | 18760490 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate |
| SMILES | CCC1(CC)NC(C)(COC(=O)C(C)(C)C)COC1=O |
| InChI | InChI=1S/C15H27NO4/c1-7-15(8-2)12(18)20-10-14(6,16-15)9-19-11(17)13(3,4)5/h16H,7-10H2,1-6H3 |
| InChIKey | BTSDTBBXGVOIDN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate?
The IUPAC name of (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate (CID 18760490) is (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate.
What is the SMILES notation for (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate?
The canonical SMILES for (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate is CCC1(CC)NC(C)(COC(=O)C(C)(C)C)COC1=O.
What is the InChIKey of (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate?
The InChIKey is BTSDTBBXGVOIDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO4/c1-7-15(8-2)12(18)20-10-14(6,16-15)9-19-11(17)13(3,4)5/h16H,7-10H2,1-6H3.
What are the key properties of (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate?
(5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate has a molecular weight of 285.38 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-diethyl-3-methyl-6-oxomorpholin-3-yl)methyl 2,2-dimethylpropanoate is sourced from PubChem (CID 18760490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).