About 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one
3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one (PubChem CID 18760502) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one.
Molecular Properties
| Compound Name | 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one |
| PubChem CID | 18760502 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one |
| SMILES | CCC1(CC)C(=O)N(C(C)C)CC(C)(C)N1O |
| InChI | InChI=1S/C13H26N2O2/c1-7-13(8-2)11(16)14(10(3)4)9-12(5,6)15(13)17/h10,17H,7-9H2,1-6H3 |
| InChIKey | AYPPSFDYCIPMPG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one?
The IUPAC name of 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one (CID 18760502) is 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one.
What is the SMILES notation for 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one?
The canonical SMILES for 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one is CCC1(CC)C(=O)N(C(C)C)CC(C)(C)N1O.
What is the InChIKey of 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one?
The InChIKey is AYPPSFDYCIPMPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-7-13(8-2)11(16)14(10(3)4)9-12(5,6)15(13)17/h10,17H,7-9H2,1-6H3.
What are the key properties of 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one?
3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one has a molecular weight of 242.36 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyl-4-hydroxy-5,5-dimethyl-1-propan-2-ylpiperazin-2-one is sourced from PubChem (CID 18760502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).